C28H27F3N6OS — CID 123419318
1-(2-cyclopentylphenyl)-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea (PubChem CID 123419318) has the molecular formula C28H27F3N6OS and a molecular weight of 552.63 g/mol. Its IUPAC name is 1-(2-cyclopentylphenyl)-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2-cyclopentylphenyl)-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 123419318 |
| Molecular Formula | C28H27F3N6OS |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 1-(2-cyclopentylphenyl)-3-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]thiourea |
| SMILES | N/C(=N\C=N\c1ccc(OC(F)(F)F)cc1)c1ccc(/C=N\NC(=S)Nc2ccccc2C2CCCC2)cc1 |
| InChI | InChI=1S/C28H27F3N6OS/c29-28(30,31)38-23-15-13-22(14-16-23)33-18-34-26(32)21-11-9-19(10-12-21)17-35-37-27(39)36-25-8-4-3-7-24(25)20-5-1-2-6-20/h3-4,7-18,20H,1-2,5-6H2,(H2,32,33,34)(H2,36,37,39)/b35-17- |
| InChIKey | HYUPDWLPFPWXSL-QMRORBIVSA-N |
| XLogP | 6.63 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|