C26H23Cl2F3N6OS — CID 123434018
propyl N'-(2,6-dichlorophenyl)-N-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]carbamimidothioate (PubChem CID 123434018) has the molecular formula C26H23Cl2F3N6OS and a molecular weight of 595.48 g/mol. Its IUPAC name is propyl N'-(2,6-dichlorophenyl)-N-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | propyl N'-(2,6-dichlorophenyl)-N-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 123434018 |
| Molecular Formula | C26H23Cl2F3N6OS |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | propyl N'-(2,6-dichlorophenyl)-N-[(Z)-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino]carbamimidothioate |
| SMILES | CCCS/C(=N\c1c(Cl)cccc1Cl)N/N=C\c1ccc(/C(N)=N/C=N/c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H23Cl2F3N6OS/c1-2-14-39-25(36-23-21(27)4-3-5-22(23)28)37-35-15-17-6-8-18(9-7-17)24(32)34-16-33-19-10-12-20(13-11-19)38-26(29,30)31/h3-13,15-16H,2,14H2,1H3,(H,36,37)(H2,32,33,34)/b35-15- |
| InChIKey | SWWIMWQGOPRLOM-BYDMSBDESA-N |
| XLogP | 7.71 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|