C27H27F3N6O2 — CID 145161965
[(E)-[4-[N'-[[4-[methyl(trifluoromethyl)amino]phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino] N-(2-propan-2-ylphenyl)carbamate (PubChem CID 145161965) has the molecular formula C27H27F3N6O2 and a molecular weight of 524.55 g/mol. Its IUPAC name is [(E)-[4-[N'-[[4-[methyl(trifluoromethyl)amino]phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino] N-(2-propan-2-ylphenyl)carbamate.
| Compound Name | [(E)-[4-[N'-[[4-[methyl(trifluoromethyl)amino]phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino] N-(2-propan-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 145161965 |
| Molecular Formula | C27H27F3N6O2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [(E)-[4-[N'-[[4-[methyl(trifluoromethyl)amino]phenyl]iminomethyl]carbamimidoyl]phenyl]methylideneamino] N-(2-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccccc1NC(=O)O/N=C/c1ccc(/C(N)=N/C=N/c2ccc(N(C)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C27H27F3N6O2/c1-18(2)23-6-4-5-7-24(23)35-26(37)38-34-16-19-8-10-20(11-9-19)25(31)33-17-32-21-12-14-22(15-13-21)36(3)27(28,29)30/h4-18H,1-3H3,(H,35,37)(H2,31,32,33)/b34-16+ |
| InChIKey | LAKOMJAEMLRCBR-AABVJFSESA-N |
| XLogP | 6.41 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|