C25H17F5N6O2S — CID 138511583
(Z)-2-cyano-3-(2,6-difluoroanilino)-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide (PubChem CID 138511583) has the molecular formula C25H17F5N6O2S and a molecular weight of 560.51 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,6-difluoroanilino)-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,6-difluoroanilino)-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 138511583 |
| Molecular Formula | C25H17F5N6O2S |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | (Z)-2-cyano-3-(2,6-difluoroanilino)-3-sulfanyl-N-[4-[N'-[[4-(trifluoromethoxy)phenyl]iminomethyl]carbamimidoyl]phenyl]prop-2-enamide |
| SMILES | N#C/C(C(=O)Nc1ccc(/C(N)=N/C=N/c2ccc(OC(F)(F)F)cc2)cc1)=C(/S)Nc1c(F)cccc1F |
| InChI | InChI=1S/C25H17F5N6O2S/c26-19-2-1-3-20(27)21(19)36-24(39)18(12-31)23(37)35-16-6-4-14(5-7-16)22(32)34-13-33-15-8-10-17(11-9-15)38-25(28,29)30/h1-11,13,36,39H,(H,35,37)(H2,32,33,34)/b24-18- |
| InChIKey | WOIUKUBVPKJBCF-MOHJPFBDSA-N |
| XLogP | 5.64 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|