C9H8F3N3O3 — CID 53274904
(2E)-2-amino-2-hydroxyimino-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 53274904) has the molecular formula C9H8F3N3O3 and a molecular weight of 263.18 g/mol. Its IUPAC name is (2E)-2-amino-2-hydroxyimino-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | (2E)-2-amino-2-hydroxyimino-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 53274904 |
| Molecular Formula | C9H8F3N3O3 |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (2E)-2-amino-2-hydroxyimino-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N/C(=N/O)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3N3O3/c10-9(11,12)18-6-3-1-5(2-4-6)14-8(16)7(13)15-17/h1-4,17H,(H2,13,15)(H,14,16) |
| InChIKey | FLSAWDKOMOMDTN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|