C26H22F3N5O2S — CID 161358287
1-(2-ethylbenzenecarbothioyl)-3-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]urea (PubChem CID 161358287) has the molecular formula C26H22F3N5O2S and a molecular weight of 525.56 g/mol. Its IUPAC name is 1-(2-ethylbenzenecarbothioyl)-3-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-(2-ethylbenzenecarbothioyl)-3-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 161358287 |
| Molecular Formula | C26H22F3N5O2S |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-(2-ethylbenzenecarbothioyl)-3-[[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]urea |
| SMILES | CCc1ccccc1C(=S)NC(=O)NCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C26H22F3N5O2S/c1-2-18-7-3-4-9-22(18)24(37)32-25(35)30-15-17-6-5-8-19(14-17)23-31-16-34(33-23)20-10-12-21(13-11-20)36-26(27,28)29/h3-14,16H,2,15H2,1H3,(H2,30,32,35,37) |
| InChIKey | VOVHIHONHQYDFX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|