C32H32ClF3N6O2S — CID 129294777
(1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 129294777) has the molecular formula C32H32ClF3N6O2S and a molecular weight of 657.16 g/mol. Its IUPAC name is (1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | (1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 129294777 |
| Molecular Formula | C32H32ClF3N6O2S |
| Molecular Weight | 657.16 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | (1Z)-1-[3-(5-chloro-2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | CC(C)c1ccc(Cl)cc1N1CCS/C1=N\C(=O)NCCCCc1cccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)c1 |
| InChI | InChI=1S/C32H32ClF3N6O2S/c1-21(2)27-14-9-24(33)19-28(27)41-16-17-45-31(41)39-30(43)37-15-4-3-6-22-7-5-8-23(18-22)29-38-20-42(40-29)25-10-12-26(13-11-25)44-32(34,35)36/h5,7-14,18-21H,3-4,6,15-17H2,1-2H3,(H,37,43)/b39-31- |
| InChIKey | UCVPGNQSWGGOIX-RZLPTWENSA-N |
| XLogP | 8.25 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.16 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|