C31H31F3N6O3S — CID 171923202
1-[3-(4-methoxy-2-methylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 171923202) has the molecular formula C31H31F3N6O3S and a molecular weight of 624.69 g/mol. Its IUPAC name is 1-[3-(4-methoxy-2-methylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | 1-[3-(4-methoxy-2-methylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 171923202 |
| Molecular Formula | C31H31F3N6O3S |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | 1-[3-(4-methoxy-2-methylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[3-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | COc1ccc(N2CCSC2=NC(=O)NCCCCc2cccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)c2)c(C)c1 |
| InChI | InChI=1S/C31H31F3N6O3S/c1-21-18-26(42-2)13-14-27(21)39-16-17-44-30(39)37-29(41)35-15-4-3-6-22-7-5-8-23(19-22)28-36-20-40(38-28)24-9-11-25(12-10-24)43-31(32,33)34/h5,7-14,18-20H,3-4,6,15-17H2,1-2H3,(H,35,41) |
| InChIKey | COBRNPZWTRPTCS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|