C27H26F3N5O3 — CID 118675053
1-(2-methoxyphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 118675053) has the molecular formula C27H26F3N5O3 and a molecular weight of 525.53 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 118675053 |
| Molecular Formula | C27H26F3N5O3 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[4-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | COc1ccccc1NC(=O)NCCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C27H26F3N5O3/c1-37-24-8-3-2-7-23(24)33-26(36)31-17-5-4-6-19-9-11-20(12-10-19)25-32-18-35(34-25)21-13-15-22(16-14-21)38-27(28,29)30/h2-3,7-16,18H,4-6,17H2,1H3,(H2,31,33,36) |
| InChIKey | ANPMOARCEBCQPF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|