C32H35F3N6OS — CID 123159302
1-[(5-ethyl-2-propan-2-ylphenyl)carbamothioyl]-3-[4-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea (PubChem CID 123159302) has the molecular formula C32H35F3N6OS and a molecular weight of 608.73 g/mol. Its IUPAC name is 1-[(5-ethyl-2-propan-2-ylphenyl)carbamothioyl]-3-[4-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea.
| Compound Name | 1-[(5-ethyl-2-propan-2-ylphenyl)carbamothioyl]-3-[4-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 123159302 |
| Molecular Formula | C32H35F3N6OS |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | 1-[(5-ethyl-2-propan-2-ylphenyl)carbamothioyl]-3-[4-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]butyl]urea |
| SMILES | CCc1ccc(C(C)C)c(NC(=S)NC(=O)NCCCCc2ccc(-c3ncn(-c4ccc(C(F)(F)F)cc4)n3)cc2)c1 |
| InChI | InChI=1S/C32H35F3N6OS/c1-4-22-10-17-27(21(2)3)28(19-22)38-31(43)39-30(42)36-18-6-5-7-23-8-11-24(12-9-23)29-37-20-41(40-29)26-15-13-25(14-16-26)32(33,34)35/h8-17,19-21H,4-7,18H2,1-3H3,(H3,36,38,39,42,43) |
| InChIKey | JSKIYJKTZVLJLH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|