C24H28F3N7OS — CID 162752993
2-methyl-5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,2,4-triazole-3-carboxamide (PubChem CID 162752993) has the molecular formula C24H28F3N7OS and a molecular weight of 519.60 g/mol. Its IUPAC name is 2-methyl-5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 2-methyl-5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162752993 |
| Molecular Formula | C24H28F3N7OS |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 2-methyl-5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=S)NNCc1ccc(-c2nc(C(=O)NCCC(F)(F)F)n(C)n2)cc1 |
| InChI | InChI=1S/C24H28F3N7OS/c1-15(2)18-6-4-5-7-19(18)30-23(36)32-29-14-16-8-10-17(11-9-16)20-31-21(34(3)33-20)22(35)28-13-12-24(25,26)27/h4-11,15,29H,12-14H2,1-3H3,(H,28,35)(H2,30,32,36) |
| InChIKey | IXGNXSYQDTWTJD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|