C30H34F3N7O2S — CID 167211404
1-[[4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 167211404) has the molecular formula C30H34F3N7O2S and a molecular weight of 613.71 g/mol. Its IUPAC name is 1-[[4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[[4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 167211404 |
| Molecular Formula | C30H34F3N7O2S |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 1-[[4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CCOCCNc1nc(-c2ccc(CNNC(=S)Nc3ccccc3C(C)C)cc2)nn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C30H34F3N7O2S/c1-4-41-18-17-34-28-37-27(39-40(28)23-13-15-24(16-14-23)42-30(31,32)33)22-11-9-21(10-12-22)19-35-38-29(43)36-26-8-6-5-7-25(26)20(2)3/h5-16,20,35H,4,17-19H2,1-3H3,(H,34,37,39)(H2,36,38,43) |
| InChIKey | GCKVIHDSGCLVHP-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|