C31H34F5N7OS — CID 167211356
N-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-5-[4-[[2-[3-(2-propan-2-ylphenyl)-1,3-thiazinan-2-yl]hydrazinyl]methyl]phenyl]-1,2,4-triazol-3-amine (PubChem CID 167211356) has the molecular formula C31H34F5N7OS and a molecular weight of 647.72 g/mol. Its IUPAC name is N-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-5-[4-[[2-[3-(2-propan-2-ylphenyl)-1,3-thiazinan-2-yl]hydrazinyl]methyl]phenyl]-1,2,4-triazol-3-amine.
| Compound Name | N-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-5-[4-[[2-[3-(2-propan-2-ylphenyl)-1,3-thiazinan-2-yl]hydrazinyl]methyl]phenyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 167211356 |
| Molecular Formula | C31H34F5N7OS |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | N-methyl-2-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-5-[4-[[2-[3-(2-propan-2-ylphenyl)-1,3-thiazinan-2-yl]hydrazinyl]methyl]phenyl]-1,2,4-triazol-3-amine |
| SMILES | CNc1nc(-c2ccc(CNNC3SCCCN3c3ccccc3C(C)C)cc2)nn1-c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H34F5N7OS/c1-20(2)25-7-4-5-8-26(25)42-17-6-18-45-29(42)40-38-19-21-9-11-22(12-10-21)27-39-28(37-3)43(41-27)23-13-15-24(16-14-23)44-31(35,36)30(32,33)34/h4-5,7-16,20,29,38,40H,6,17-19H2,1-3H3,(H,37,39,41) |
| InChIKey | YQMFWNDJCSXLKM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|