C30H30F3N7O2S — CID 167211442
N-[5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclopropanecarboxamide (PubChem CID 167211442) has the molecular formula C30H30F3N7O2S and a molecular weight of 609.68 g/mol. Its IUPAC name is N-[5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167211442 |
| Molecular Formula | C30H30F3N7O2S |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | N-[5-[4-[[2-[(2-propan-2-ylphenyl)carbamothioyl]hydrazinyl]methyl]phenyl]-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]cyclopropanecarboxamide |
| SMILES | CC(C)c1ccccc1NC(=S)NNCc1ccc(-c2nc(NC(=O)C3CC3)n(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H30F3N7O2S/c1-18(2)24-5-3-4-6-25(24)35-29(43)38-34-17-19-7-9-20(10-8-19)26-36-28(37-27(41)21-11-12-21)40(39-26)22-13-15-23(16-14-22)42-30(31,32)33/h3-10,13-16,18,21,34H,11-12,17H2,1-2H3,(H2,35,38,43)(H,36,37,39,41) |
| InChIKey | FICZPZNSXPWYOV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|