C33H34F5N7O4S — CID 167211741
1-[2-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-yl]ethyl]-3-[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 167211741) has the molecular formula C33H34F5N7O4S and a molecular weight of 719.74 g/mol. Its IUPAC name is 1-[2-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-yl]ethyl]-3-[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[2-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-yl]ethyl]-3-[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 167211741 |
| Molecular Formula | C33H34F5N7O4S |
| Molecular Weight | 719.74 g/mol |
| Exact Mass | 719.23 |
| IUPAC Name | 1-[2-[3-(5-methoxy-2-propan-2-ylphenyl)-4-oxo-1,3-thiazolidin-2-yl]ethyl]-3-[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CNc1nc(-c2ccc(NC(=O)NCCC3SCC(=O)N3c3cc(OC)ccc3C(C)C)cc2)nn1-c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H34F5N7O4S/c1-19(2)25-14-13-24(48-4)17-26(25)44-27(46)18-50-28(44)15-16-40-31(47)41-21-7-5-20(6-8-21)29-42-30(39-3)45(43-29)22-9-11-23(12-10-22)49-33(37,38)32(34,35)36/h5-14,17,19,28H,15-16,18H2,1-4H3,(H,39,42,43)(H2,40,41,47) |
| InChIKey | NCOUOGLVFKUOHZ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|