C28H23F8N5O3 — CID 163604913
1-[4-[5-butyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 163604913) has the molecular formula C28H23F8N5O3 and a molecular weight of 629.51 g/mol. Its IUPAC name is 1-[4-[5-butyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-[5-butyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 163604913 |
| Molecular Formula | C28H23F8N5O3 |
| Molecular Weight | 629.51 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | 1-[4-[5-butyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | CCCCc1nc(-c2ccc(NC(=O)Nc3ccccc3OC(F)(F)F)cc2)nn1-c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H23F8N5O3/c1-2-3-8-23-39-24(40-41(23)19-13-15-20(16-14-19)43-27(32,33)26(29,30)31)17-9-11-18(12-10-17)37-25(42)38-21-6-4-5-7-22(21)44-28(34,35)36/h4-7,9-16H,2-3,8H2,1H3,(H2,37,38,42) |
| InChIKey | HAXMVSQXJFGEMV-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.51 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|