C20H21F3N6O3 — CID 167212236
[4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 167212236) has the molecular formula C20H21F3N6O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is [4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | [4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 167212236 |
| Molecular Formula | C20H21F3N6O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | [4-[5-(2-ethoxyethylamino)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CCOCCNc1nc(-c2ccc(NC(N)=O)cc2)nn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N6O3/c1-2-31-12-11-25-19-27-17(13-3-5-14(6-4-13)26-18(24)30)28-29(19)15-7-9-16(10-8-15)32-20(21,22)23/h3-10H,2,11-12H2,1H3,(H3,24,26,30)(H,25,27,28) |
| InChIKey | XPTVYKBQGRJDLO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|