C18H18F3N5O — CID 163216385
5-(4-aminophenyl)-N-propan-2-yl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine (PubChem CID 163216385) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is 5-(4-aminophenyl)-N-propan-2-yl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-aminophenyl)-N-propan-2-yl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 163216385 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-(4-aminophenyl)-N-propan-2-yl-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine |
| SMILES | CC(C)Nc1nc(-c2ccc(N)cc2)nn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H18F3N5O/c1-11(2)23-17-24-16(12-3-5-13(22)6-4-12)25-26(17)14-7-9-15(10-8-14)27-18(19,20)21/h3-11H,22H2,1-2H3,(H,23,24,25) |
| InChIKey | BIUWKAHNFFAIHS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|