C15H12F3N5O — CID 155586796
5-(4-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine (PubChem CID 155586796) has the molecular formula C15H12F3N5O and a molecular weight of 335.29 g/mol. Its IUPAC name is 5-(4-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 155586796 |
| Molecular Formula | C15H12F3N5O |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 5-(4-aminophenyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-amine |
| SMILES | Nc1ccc(-c2nc(N)n(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C15H12F3N5O/c16-15(17,18)24-12-7-5-11(6-8-12)23-14(20)21-13(22-23)9-1-3-10(19)4-2-9/h1-8H,19H2,(H2,20,21,22) |
| InChIKey | CYJQXWXKRQZNCO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|