C10H6ClF3N4O — CID 116629481
4-chloro-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 116629481) has the molecular formula C10H6ClF3N4O and a molecular weight of 290.63 g/mol. Its IUPAC name is 4-chloro-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 116629481 |
| Molecular Formula | C10H6ClF3N4O |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-chloro-6-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C10H6ClF3N4O/c11-8-16-7(17-9(15)18-8)5-1-3-6(4-2-5)19-10(12,13)14/h1-4H,(H2,15,16,17,18) |
| InChIKey | LITIZGFZXZMGEZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |