C20H18F3N5O2 — CID 167212204
4-[5-[2-(dimethylamino)aziridin-1-yl]-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzaldehyde (PubChem CID 167212204) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is 4-[5-[2-(dimethylamino)aziridin-1-yl]-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzaldehyde.
| Compound Name | 4-[5-[2-(dimethylamino)aziridin-1-yl]-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzaldehyde |
|---|---|
| PubChem CID | 167212204 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-[5-[2-(dimethylamino)aziridin-1-yl]-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzaldehyde |
| SMILES | CN(C)C1CN1c1nc(-c2ccc(C=O)cc2)nn1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3N5O2/c1-26(2)17-11-27(17)19-24-18(14-5-3-13(12-29)4-6-14)25-28(19)15-7-9-16(10-8-15)30-20(21,22)23/h3-10,12,17H,11H2,1-2H3 |
| InChIKey | BCZXDYGSQMPUFP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|