C18H13F3IN3O — CID 4563012
3-(4-iodophenyl)-1-[4-(trifluoromethoxy)phenyl]-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 4563012) has the molecular formula C18H13F3IN3O and a molecular weight of 471.22 g/mol. Its IUPAC name is 3-(4-iodophenyl)-1-[4-(trifluoromethoxy)phenyl]-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
| Compound Name | 3-(4-iodophenyl)-1-[4-(trifluoromethoxy)phenyl]-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 4563012 |
| Molecular Formula | C18H13F3IN3O |
| Molecular Weight | 471.22 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 3-(4-iodophenyl)-1-[4-(trifluoromethoxy)phenyl]-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | FC(F)(F)Oc1ccc(-n2nc(-c3ccc(I)cc3)c3c2NCC3)cc1 |
| InChI | InChI=1S/C18H13F3IN3O/c19-18(20,21)26-14-7-5-13(6-8-14)25-17-15(9-10-23-17)16(24-25)11-1-3-12(22)4-2-11/h1-8,23H,9-10H2 |
| InChIKey | RLXZHLSPCMOBFA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.22 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|