C17H13FIN3 — CID 3574802
3-(3-fluorophenyl)-1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole (PubChem CID 3574802) has the molecular formula C17H13FIN3 and a molecular weight of 405.21 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole.
| Compound Name | 3-(3-fluorophenyl)-1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
|---|---|
| PubChem CID | 3574802 |
| Molecular Formula | C17H13FIN3 |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 3-(3-fluorophenyl)-1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazole |
| SMILES | Fc1cccc(-c2nn(-c3ccc(I)cc3)c3c2CCN3)c1 |
| InChI | InChI=1S/C17H13FIN3/c18-12-3-1-2-11(10-12)16-15-8-9-20-17(15)22(21-16)14-6-4-13(19)5-7-14/h1-7,10,20H,8-9H2 |
| InChIKey | FOFUWUUEIDNEHO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|