C19H19IN4 — CID 3915467
3-[1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazol-3-yl]-N,N-dimethylaniline (PubChem CID 3915467) has the molecular formula C19H19IN4 and a molecular weight of 430.29 g/mol. Its IUPAC name is 3-[1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 3-[1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3915467 |
| Molecular Formula | C19H19IN4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 3-[1-(4-iodophenyl)-5,6-dihydro-4H-pyrrolo[3,2-d]pyrazol-3-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(-c2nn(-c3ccc(I)cc3)c3c2CCN3)c1 |
| InChI | InChI=1S/C19H19IN4/c1-23(2)16-5-3-4-13(12-16)18-17-10-11-21-19(17)24(22-18)15-8-6-14(20)7-9-15/h3-9,12,21H,10-11H2,1-2H3 |
| InChIKey | GHHMHSKWMXCDTH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|