C27H35F2N3O2 — CID 155586751
4-[1-[4-(1,1-difluoroethoxy)phenyl]-5-hex-5-enyl-1,2,4-triazol-3-yl]benzaldehyde;ethane (PubChem CID 155586751) has the molecular formula C27H35F2N3O2 and a molecular weight of 471.59 g/mol. Its IUPAC name is 4-[1-[4-(1,1-difluoroethoxy)phenyl]-5-hex-5-enyl-1,2,4-triazol-3-yl]benzaldehyde;ethane.
| Compound Name | 4-[1-[4-(1,1-difluoroethoxy)phenyl]-5-hex-5-enyl-1,2,4-triazol-3-yl]benzaldehyde;ethane |
|---|---|
| PubChem CID | 155586751 |
| Molecular Formula | C27H35F2N3O2 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 4-[1-[4-(1,1-difluoroethoxy)phenyl]-5-hex-5-enyl-1,2,4-triazol-3-yl]benzaldehyde;ethane |
| SMILES | C=CCCCCc1nc(-c2ccc(C=O)cc2)nn1-c1ccc(OC(C)(F)F)cc1.CC.CC |
| InChI | InChI=1S/C23H23F2N3O2.2C2H6/c1-3-4-5-6-7-21-26-22(18-10-8-17(16-29)9-11-18)27-28(21)19-12-14-20(15-13-19)30-23(2,24)25;2*1-2/h3,8-16H,1,4-7H2,2H3;2*1-2H3 |
| InChIKey | KWQPEABDMIPFGV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|