C30H31F3N4O4 — CID 4642874
4-butoxy-N-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide (PubChem CID 4642874) has the molecular formula C30H31F3N4O4 and a molecular weight of 568.60 g/mol. Its IUPAC name is 4-butoxy-N-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4642874 |
| Molecular Formula | C30H31F3N4O4 |
| Molecular Weight | 568.60 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 4-butoxy-N-[4-[3-(2-ethoxyethoxy)-5-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(-n3nc(OCCOCC)nc3-c3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H31F3N4O4/c1-3-5-18-40-26-16-8-22(9-17-26)28(38)34-24-12-14-25(15-13-24)37-27(35-29(36-37)41-20-19-39-4-2)21-6-10-23(11-7-21)30(31,32)33/h6-17H,3-5,18-20H2,1-2H3,(H,34,38) |
| InChIKey | IGEHYQUYZLMLBU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|