C32H34F5N7O2S — CID 167211758
2-[[2-methyl-2-[[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]hydrazinyl]methyl]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one (PubChem CID 167211758) has the molecular formula C32H34F5N7O2S and a molecular weight of 675.73 g/mol. Its IUPAC name is 2-[[2-methyl-2-[[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]hydrazinyl]methyl]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[[2-methyl-2-[[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]hydrazinyl]methyl]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 167211758 |
| Molecular Formula | C32H34F5N7O2S |
| Molecular Weight | 675.73 g/mol |
| Exact Mass | 675.24 |
| IUPAC Name | 2-[[2-methyl-2-[[4-[5-(methylamino)-1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methyl]hydrazinyl]methyl]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CNc1nc(-c2ccc(CN(C)NCC3SCC(=O)N3c3ccccc3C(C)C)cc2)nn1-c1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C32H34F5N7O2S/c1-20(2)25-7-5-6-8-26(25)43-27(45)19-47-28(43)17-39-42(4)18-21-9-11-22(12-10-21)29-40-30(38-3)44(41-29)23-13-15-24(16-14-23)46-32(36,37)31(33,34)35/h5-16,20,28,39H,17-19H2,1-4H3,(H,38,40,41) |
| InChIKey | KYRGGOKLCKFZDE-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|