C23H26F3N7S — CID 163204492
1-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 163204492) has the molecular formula C23H26F3N7S and a molecular weight of 489.57 g/mol. Its IUPAC name is 1-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 163204492 |
| Molecular Formula | C23H26F3N7S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)NN=Cc1ccc(-c2nc(NCCC(F)(F)F)n(C)n2)cc1 |
| InChI | InChI=1S/C23H26F3N7S/c1-15(2)18-6-4-5-7-19(18)29-22(34)31-28-14-16-8-10-17(11-9-16)20-30-21(33(3)32-20)27-13-12-23(24,25)26/h4-11,14-15H,12-13H2,1-3H3,(H,27,30,32)(H2,29,31,34) |
| InChIKey | PQVUZLANKQXTGZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|