C25H26F3N7OS — CID 163204483
2-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one (PubChem CID 163204483) has the molecular formula C25H26F3N7OS and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 163204483 |
| Molecular Formula | C25H26F3N7OS |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 2-[[4-[1-methyl-5-(3,3,3-trifluoropropylamino)-1,2,4-triazol-3-yl]phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1ccccc1N1C(=O)CSC1=NN=Cc1ccc(-c2nc(NCCC(F)(F)F)n(C)n2)cc1 |
| InChI | InChI=1S/C25H26F3N7OS/c1-16(2)19-6-4-5-7-20(19)35-21(36)15-37-24(35)32-30-14-17-8-10-18(11-9-17)22-31-23(34(3)33-22)29-13-12-25(26,27)28/h4-11,14,16H,12-13,15H2,1-3H3,(H,29,31,33) |
| InChIKey | YNEIEFOFIBXVTG-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|