C26H25F5N6O2S — CID 126642555
(1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 126642555) has the molecular formula C26H25F5N6O2S and a molecular weight of 580.58 g/mol. Its IUPAC name is (1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | (1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 126642555 |
| Molecular Formula | C26H25F5N6O2S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,5,5,5-pentafluoropentyl)-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CC(C)c1ccccc1N1C(=O)CS/C1=N\C(=O)Nc1ccc(-c2ncn(CCCC(F)(F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C26H25F5N6O2S/c1-16(2)19-6-3-4-7-20(19)37-21(38)14-40-24(37)34-23(39)33-18-10-8-17(9-11-18)22-32-15-36(35-22)13-5-12-25(27,28)26(29,30)31/h3-4,6-11,15-16H,5,12-14H2,1-2H3,(H,33,39)/b34-24- |
| InChIKey | AELSUFABEXRATI-BCJTWVECSA-N |
| XLogP | 6.71 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|