C29H27BrN6O2S — CID 154520496
1-[4-[2-[1-(4-bromophenyl)-1,2,4-triazol-3-yl]ethyl]phenyl]-3-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]urea (PubChem CID 154520496) has the molecular formula C29H27BrN6O2S and a molecular weight of 603.55 g/mol. Its IUPAC name is 1-[4-[2-[1-(4-bromophenyl)-1,2,4-triazol-3-yl]ethyl]phenyl]-3-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[4-[2-[1-(4-bromophenyl)-1,2,4-triazol-3-yl]ethyl]phenyl]-3-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 154520496 |
| Molecular Formula | C29H27BrN6O2S |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | 1-[4-[2-[1-(4-bromophenyl)-1,2,4-triazol-3-yl]ethyl]phenyl]-3-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]urea |
| SMILES | CC(C)c1ccccc1N1C(=O)CSC1=NC(=O)Nc1ccc(CCc2ncn(-c3ccc(Br)cc3)n2)cc1 |
| InChI | InChI=1S/C29H27BrN6O2S/c1-19(2)24-5-3-4-6-25(24)36-27(37)17-39-29(36)33-28(38)32-22-12-7-20(8-13-22)9-16-26-31-18-35(34-26)23-14-10-21(30)11-15-23/h3-8,10-15,18-19H,9,16-17H2,1-2H3,(H,32,38) |
| InChIKey | QOZFAMFKPXMOAD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|