C25H25F3N6O2S — CID 126653459
(1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 126653459) has the molecular formula C25H25F3N6O2S and a molecular weight of 530.58 g/mol. Its IUPAC name is (1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | (1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 126653459 |
| Molecular Formula | C25H25F3N6O2S |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (1Z)-1-[4-oxo-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4,4,4-trifluorobutyl)-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CC(C)c1ccccc1N1C(=O)CS/C1=N\C(=O)Nc1ccc(-c2ncn(CCCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C25H25F3N6O2S/c1-16(2)19-6-3-4-7-20(19)34-21(35)14-37-24(34)31-23(36)30-18-10-8-17(9-11-18)22-29-15-33(32-22)13-5-12-25(26,27)28/h3-4,6-11,15-16H,5,12-14H2,1-2H3,(H,30,36)/b31-24- |
| InChIKey | GZRSIIGQSUDPLP-QLTSDVKISA-N |
| XLogP | 6.08 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|