C27H24N6O2S — CID 159562938
1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 159562938) has the molecular formula C27H24N6O2S and a molecular weight of 496.60 g/mol. Its IUPAC name is 1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 159562938 |
| Molecular Formula | C27H24N6O2S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-[3-(2-ethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | CCc1ccccc1N1C(=O)CSC1=NC(=O)Nc1ccc(-c2ncn(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C27H24N6O2S/c1-3-19-6-4-5-7-23(19)33-24(34)16-36-27(33)30-26(35)29-21-12-10-20(11-13-21)25-28-17-32(31-25)22-14-8-18(2)9-15-22/h4-15,17H,3,16H2,1-2H3,(H,29,35) |
| InChIKey | MGVQUEPAPKFDQK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|