C28H25FN6O2S — CID 175366584
1-[2-fluoro-4-(1-phenyl-1,2,4-triazol-3-yl)phenyl]-3-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 175366584) has the molecular formula C28H25FN6O2S and a molecular weight of 528.61 g/mol. Its IUPAC name is 1-[2-fluoro-4-(1-phenyl-1,2,4-triazol-3-yl)phenyl]-3-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[2-fluoro-4-(1-phenyl-1,2,4-triazol-3-yl)phenyl]-3-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 175366584 |
| Molecular Formula | C28H25FN6O2S |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-[2-fluoro-4-(1-phenyl-1,2,4-triazol-3-yl)phenyl]-3-[3-(5-methyl-2-propylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | CCCc1ccc(C)cc1N1C(=O)CSC1=NC(=O)Nc1ccc(-c2ncn(-c3ccccc3)n2)cc1F |
| InChI | InChI=1S/C28H25FN6O2S/c1-3-7-19-11-10-18(2)14-24(19)35-25(36)16-38-28(35)32-27(37)31-23-13-12-20(15-22(23)29)26-30-17-34(33-26)21-8-5-4-6-9-21/h4-6,8-15,17H,3,7,16H2,1-2H3,(H,31,37) |
| InChIKey | GYAUMUTUOZTYOY-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 92.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|