C30H23F4N7O3S — CID 155581185
(3Z)-1-[4-[1-[4-(cyanomethyl)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 155581185) has the molecular formula C30H23F4N7O3S and a molecular weight of 637.62 g/mol. Its IUPAC name is (3Z)-1-[4-[1-[4-(cyanomethyl)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[4-[1-[4-(cyanomethyl)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 155581185 |
| Molecular Formula | C30H23F4N7O3S |
| Molecular Weight | 637.62 g/mol |
| Exact Mass | 637.15 |
| IUPAC Name | (3Z)-1-[4-[1-[4-(cyanomethyl)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(COCC(F)(F)F)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(-c3ncn(-c4ccc(CC#N)cc4)n3)cc2F)c1 |
| InChI | InChI=1S/C30H23F4N7O3S/c1-18-2-5-21(14-44-16-30(32,33)34)25(12-18)41-26(42)15-45-29(41)38-28(43)37-24-9-6-20(13-23(24)31)27-36-17-40(39-27)22-7-3-19(4-8-22)10-11-35/h2-9,12-13,17H,10,14-16H2,1H3,(H,37,43)/b38-29- |
| InChIKey | ZKYOOFUHVUKYKC-ZDNCSJAVSA-N |
| XLogP | 6.19 |
| TPSA | 125.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|