C29H21F7N6O3S — CID 172814701
1-[2-fluoro-4-[3-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 172814701) has the molecular formula C29H21F7N6O3S and a molecular weight of 666.58 g/mol. Its IUPAC name is 1-[2-fluoro-4-[3-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[2-fluoro-4-[3-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 172814701 |
| Molecular Formula | C29H21F7N6O3S |
| Molecular Weight | 666.58 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | 1-[2-fluoro-4-[3-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(COCC(F)(F)F)c(N2C(=O)CSC2=NC(=O)Nc2ccc(-n3cnc(-c4ccc(C(F)(F)F)cc4)n3)cc2F)c1 |
| InChI | InChI=1S/C29H21F7N6O3S/c1-16-2-3-18(12-45-14-28(31,32)33)23(10-16)42-24(43)13-46-27(42)39-26(44)38-22-9-8-20(11-21(22)30)41-15-37-25(40-41)17-4-6-19(7-5-17)29(34,35)36/h2-11,15H,12-14H2,1H3,(H,38,44) |
| InChIKey | SQRKBHMVUAHQEI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.58 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|