C30H22F8N6O4S — CID 172798300
1-[2-(difluoromethyl)-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 172798300) has the molecular formula C30H22F8N6O4S and a molecular weight of 714.60 g/mol. Its IUPAC name is 1-[2-(difluoromethyl)-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[2-(difluoromethyl)-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 172798300 |
| Molecular Formula | C30H22F8N6O4S |
| Molecular Weight | 714.60 g/mol |
| Exact Mass | 714.13 |
| IUPAC Name | 1-[2-(difluoromethyl)-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-[5-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(COCC(F)(F)F)c(N2C(=O)CSC2=NC(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2C(F)F)c1 |
| InChI | InChI=1S/C30H22F8N6O4S/c1-16-2-3-18(12-47-14-29(33,34)35)23(10-16)44-24(45)13-49-28(44)41-27(46)40-22-9-4-17(11-21(22)25(31)32)26-39-15-43(42-26)19-5-7-20(8-6-19)48-30(36,37)38/h2-11,15,25H,12-14H2,1H3,(H,40,46) |
| InChIKey | QMVAAWTWYXUSDT-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|