C29H24F4N6O4S — CID 178018113
(3Z)-1-[4-[1-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[2-(2-fluoroethoxymethyl)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 178018113) has the molecular formula C29H24F4N6O4S and a molecular weight of 628.61 g/mol. Its IUPAC name is (3Z)-1-[4-[1-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[2-(2-fluoroethoxymethyl)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | (3Z)-1-[4-[1-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[2-(2-fluoroethoxymethyl)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 178018113 |
| Molecular Formula | C29H24F4N6O4S |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.15 |
| IUPAC Name | (3Z)-1-[4-[1-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-2-fluorophenyl]-3-[3-[2-(2-fluoroethoxymethyl)-5-methylphenyl]-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | Cc1ccc(COCCF)c(N2C(=O)CS/C2=N\C(=O)Nc2ccc(-c3ncn(-c4ccc(OC(F)F)cc4)n3)cc2F)c1 |
| InChI | InChI=1S/C29H24F4N6O4S/c1-17-2-3-19(14-42-11-10-30)24(12-17)39-25(40)15-44-29(39)36-28(41)35-23-9-4-18(13-22(23)31)26-34-16-38(37-26)20-5-7-21(8-6-20)43-27(32)33/h2-9,12-13,16,27H,10-11,14-15H2,1H3,(H,35,41)/b36-29- |
| InChIKey | LVDGCPODZZLJFZ-JTHRFTPNSA-N |
| XLogP | 6.14 |
| TPSA | 110.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|