C30H24F6N6O3S — CID 165388088
(1Z)-1-[3-[3-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-methyl-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 165388088) has the molecular formula C30H24F6N6O3S and a molecular weight of 662.62 g/mol. Its IUPAC name is (1Z)-1-[3-[3-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-methyl-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | (1Z)-1-[3-[3-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-methyl-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 165388088 |
| Molecular Formula | C30H24F6N6O3S |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 662.15 |
| IUPAC Name | (1Z)-1-[3-[3-methyl-2-(2,2,2-trifluoroethoxymethyl)phenyl]-4-oxo-1,3-thiazolidin-2-ylidene]-3-[2-methyl-4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | Cc1cc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)ccc1NC(=O)/N=C1\SCC(=O)N1c1cccc(C)c1COCC(F)(F)F |
| InChI | InChI=1S/C30H24F6N6O3S/c1-17-4-3-5-24(22(17)13-45-15-29(31,32)33)42-25(43)14-46-28(42)39-27(44)38-23-11-6-19(12-18(23)2)26-37-16-41(40-26)21-9-7-20(8-10-21)30(34,35)36/h3-12,16H,13-15H2,1-2H3,(H,38,44)/b39-28- |
| InChIKey | CORVKHSUJRJHOU-WGSLGHPRSA-N |
| XLogP | 7.32 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|