C29H17F6N7O2S — CID 164535803
(3Z)-1-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea (PubChem CID 164535803) has the molecular formula C29H17F6N7O2S and a molecular weight of 641.56 g/mol. Its IUPAC name is (3Z)-1-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea.
| Compound Name | (3Z)-1-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea |
|---|---|
| PubChem CID | 164535803 |
| Molecular Formula | C29H17F6N7O2S |
| Molecular Weight | 641.56 g/mol |
| Exact Mass | 641.11 |
| IUPAC Name | (3Z)-1-[2-fluoro-4-[1-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea |
| SMILES | O=C(/N=C1\SCC(=O)N1c1cccc2ncccc12)Nc1ccc(-c2ncn(-c3ccc(C(F)(F)C(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C29H17F6N7O2S/c30-20-13-16(25-37-15-41(40-25)18-9-7-17(8-10-18)28(31,32)29(33,34)35)6-11-22(20)38-26(44)39-27-42(24(43)14-45-27)23-5-1-4-21-19(23)3-2-12-36-21/h1-13,15H,14H2,(H,38,44)/b39-27- |
| InChIKey | PQYGWBCQFSVTJO-NOACJBATSA-N |
| XLogP | 6.94 |
| TPSA | 105.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.56 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|