C28H21F4N7O4S — CID 172834530
1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(4-methyl-2,3-dihydro-1,4-benzoxazin-8-yl)-4-oxo-1,3-thiazolidin-2-ylidene]urea (PubChem CID 172834530) has the molecular formula C28H21F4N7O4S and a molecular weight of 627.58 g/mol. Its IUPAC name is 1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(4-methyl-2,3-dihydro-1,4-benzoxazin-8-yl)-4-oxo-1,3-thiazolidin-2-ylidene]urea.
| Compound Name | 1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(4-methyl-2,3-dihydro-1,4-benzoxazin-8-yl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
|---|---|
| PubChem CID | 172834530 |
| Molecular Formula | C28H21F4N7O4S |
| Molecular Weight | 627.58 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | 1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-[3-(4-methyl-2,3-dihydro-1,4-benzoxazin-8-yl)-4-oxo-1,3-thiazolidin-2-ylidene]urea |
| SMILES | CN1CCOc2c1cccc2N1C(=O)CSC1=NC(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C28H21F4N7O4S/c1-37-11-12-42-24-21(37)3-2-4-22(24)39-23(40)14-44-27(39)35-26(41)34-20-10-5-16(13-19(20)29)25-33-15-38(36-25)17-6-8-18(9-7-17)43-28(30,31)32/h2-10,13,15H,11-12,14H2,1H3,(H,34,41) |
| InChIKey | VYYGOKHZHMVEGA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|