C29H18F4N6O3S — CID 172746098
1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(3-naphthalen-2-yl-4-oxo-1,3-thiazolidin-2-ylidene)urea (PubChem CID 172746098) has the molecular formula C29H18F4N6O3S and a molecular weight of 606.56 g/mol. Its IUPAC name is 1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(3-naphthalen-2-yl-4-oxo-1,3-thiazolidin-2-ylidene)urea.
| Compound Name | 1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(3-naphthalen-2-yl-4-oxo-1,3-thiazolidin-2-ylidene)urea |
|---|---|
| PubChem CID | 172746098 |
| Molecular Formula | C29H18F4N6O3S |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | 1-[2-fluoro-4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(3-naphthalen-2-yl-4-oxo-1,3-thiazolidin-2-ylidene)urea |
| SMILES | O=C(N=C1SCC(=O)N1c1ccc2ccccc2c1)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C29H18F4N6O3S/c30-23-14-19(26-34-16-38(37-26)20-8-10-22(11-9-20)42-29(31,32)33)6-12-24(23)35-27(41)36-28-39(25(40)15-43-28)21-7-5-17-3-1-2-4-18(17)13-21/h1-14,16H,15H2,(H,35,41) |
| InChIKey | JSZCHIPVHROXDE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|