C30H20F5N7O3S — CID 172690416
1-[2-methyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea (PubChem CID 172690416) has the molecular formula C30H20F5N7O3S and a molecular weight of 653.59 g/mol. Its IUPAC name is 1-[2-methyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea.
| Compound Name | 1-[2-methyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea |
|---|---|
| PubChem CID | 172690416 |
| Molecular Formula | C30H20F5N7O3S |
| Molecular Weight | 653.59 g/mol |
| Exact Mass | 653.13 |
| IUPAC Name | 1-[2-methyl-4-[1-[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]-3-(4-oxo-3-quinolin-5-yl-1,3-thiazolidin-2-ylidene)urea |
| SMILES | Cc1cc(-c2ncn(-c3ccc(OC(F)(F)C(F)(F)F)cc3)n2)ccc1NC(=O)N=C1SCC(=O)N1c1cccc2ncccc12 |
| InChI | InChI=1S/C30H20F5N7O3S/c1-17-14-18(26-37-16-41(40-26)19-8-10-20(11-9-19)45-30(34,35)29(31,32)33)7-12-22(17)38-27(44)39-28-42(25(43)15-46-28)24-6-2-5-23-21(24)4-3-13-36-23/h2-14,16H,15H2,1H3,(H,38,44) |
| InChIKey | BPGQCHOCCJOOQT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 114.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|