C28H26N6O3S — CID 157178855
1-[3-(4-methoxy-2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea (PubChem CID 157178855) has the molecular formula C28H26N6O3S and a molecular weight of 526.62 g/mol. Its IUPAC name is 1-[3-(4-methoxy-2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea.
| Compound Name | 1-[3-(4-methoxy-2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 157178855 |
| Molecular Formula | C28H26N6O3S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-[3-(4-methoxy-2,6-dimethylphenyl)-4-oxo-1,3-thiazolidin-2-ylidene]-3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]urea |
| SMILES | COc1cc(C)c(N2C(=O)CSC2=NC(=O)Nc2ccc(-c3ncn(-c4ccc(C)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H26N6O3S/c1-17-5-11-22(12-6-17)33-16-29-26(32-33)20-7-9-21(10-8-20)30-27(36)31-28-34(24(35)15-38-28)25-18(2)13-23(37-4)14-19(25)3/h5-14,16H,15H2,1-4H3,(H,30,36) |
| InChIKey | AOIMDQDEWYRVSJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|