C22H23N7OS — CID 163204481
2-[[4-(5-amino-1-methyl-1,2,4-triazol-3-yl)phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one (PubChem CID 163204481) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[[4-(5-amino-1-methyl-1,2,4-triazol-3-yl)phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[[4-(5-amino-1-methyl-1,2,4-triazol-3-yl)phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 163204481 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[[4-(5-amino-1-methyl-1,2,4-triazol-3-yl)phenyl]methylidenehydrazinylidene]-3-(2-propan-2-ylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1ccccc1N1C(=O)CSC1=NN=Cc1ccc(-c2nc(N)n(C)n2)cc1 |
| InChI | InChI=1S/C22H23N7OS/c1-14(2)17-6-4-5-7-18(17)29-19(30)13-31-22(29)26-24-12-15-8-10-16(11-9-15)20-25-21(23)28(3)27-20/h4-12,14H,13H2,1-3H3,(H2,23,25,27) |
| InChIKey | FTOZIMXGQQMUCZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|