C29H28F3N5O2S — CID 156901626
1-[(E)-[4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methoxy]pyrazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea (PubChem CID 156901626) has the molecular formula C29H28F3N5O2S and a molecular weight of 567.64 g/mol. Its IUPAC name is 1-[(E)-[4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methoxy]pyrazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(E)-[4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methoxy]pyrazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 156901626 |
| Molecular Formula | C29H28F3N5O2S |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 1-[(E)-[4-[1-methyl-5-[[4-(trifluoromethoxy)phenyl]methoxy]pyrazol-3-yl]phenyl]methylideneamino]-3-(2-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccccc1NC(=S)N/N=C/c1ccc(-c2cc(OCc3ccc(OC(F)(F)F)cc3)n(C)n2)cc1 |
| InChI | InChI=1S/C29H28F3N5O2S/c1-19(2)24-6-4-5-7-25(24)34-28(40)35-33-17-20-8-12-22(13-9-20)26-16-27(37(3)36-26)38-18-21-10-14-23(15-11-21)39-29(30,31)32/h4-17,19H,18H2,1-3H3,(H2,34,35,40)/b33-17+ |
| InChIKey | ADBHJBQRBSOOJD-ATZGPIRCSA-N |
| XLogP | 7.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|