C25H22F3N5 — CID 157465478
2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline (PubChem CID 157465478) has the molecular formula C25H22F3N5 and a molecular weight of 449.48 g/mol. Its IUPAC name is 2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline.
| Compound Name | 2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 157465478 |
| Molecular Formula | C25H22F3N5 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-propan-2-yl-N-[(Z)-[4-[1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]aniline |
| SMILES | CC(C)c1ccccc1N/N=C\c1ccc(-c2ncn(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C25H22F3N5/c1-17(2)22-5-3-4-6-23(22)31-30-15-18-7-9-19(10-8-18)24-29-16-33(32-24)21-13-11-20(12-14-21)25(26,27)28/h3-17,31H,1-2H3/b30-15- |
| InChIKey | FNBBKGKFCUBTSP-MNDYBZJGSA-N |
| XLogP | 6.52 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|