C19H14F3N5O2 — CID 177250906
N-[5-(4-aminophenyl)-4-cyano-1-methylpyrazol-3-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 177250906) has the molecular formula C19H14F3N5O2 and a molecular weight of 401.35 g/mol. Its IUPAC name is N-[5-(4-aminophenyl)-4-cyano-1-methylpyrazol-3-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[5-(4-aminophenyl)-4-cyano-1-methylpyrazol-3-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 177250906 |
| Molecular Formula | C19H14F3N5O2 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-[5-(4-aminophenyl)-4-cyano-1-methylpyrazol-3-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | Cn1nc(NC(=O)c2ccc(OC(F)(F)F)cc2)c(C#N)c1-c1ccc(N)cc1 |
| InChI | InChI=1S/C19H14F3N5O2/c1-27-16(11-2-6-13(24)7-3-11)15(10-23)17(26-27)25-18(28)12-4-8-14(9-5-12)29-19(20,21)22/h2-9H,24H2,1H3,(H,25,26,28) |
| InChIKey | SDPWHSPOWMQLNH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|