C23H17F3N4O2 — CID 155315729
N-[1-[4-(3-amino-5-cyano-2-pyridinyl)phenyl]cyclopropyl]-4-(trifluoromethoxy)benzamide (PubChem CID 155315729) has the molecular formula C23H17F3N4O2 and a molecular weight of 438.41 g/mol. Its IUPAC name is N-[1-[4-(3-amino-5-cyano-2-pyridinyl)phenyl]cyclopropyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-[4-(3-amino-5-cyano-2-pyridinyl)phenyl]cyclopropyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 155315729 |
| Molecular Formula | C23H17F3N4O2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-[1-[4-(3-amino-5-cyano-2-pyridinyl)phenyl]cyclopropyl]-4-(trifluoromethoxy)benzamide |
| SMILES | N#Cc1cnc(-c2ccc(C3(NC(=O)c4ccc(OC(F)(F)F)cc4)CC3)cc2)c(N)c1 |
| InChI | InChI=1S/C23H17F3N4O2/c24-23(25,26)32-18-7-3-16(4-8-18)21(31)30-22(9-10-22)17-5-1-15(2-6-17)20-19(28)11-14(12-27)13-29-20/h1-8,11,13H,9-10,28H2,(H,30,31) |
| InChIKey | TVVIAAYBYWCKFT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |