C17H16F3N3O3 — CID 137126245
2-methyl-6-oxo-N-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]-1H-pyrimidine-4-carboxamide (PubChem CID 137126245) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is 2-methyl-6-oxo-N-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]-1H-pyrimidine-4-carboxamide.
| Compound Name | 2-methyl-6-oxo-N-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 137126245 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-methyl-6-oxo-N-[1-[4-(trifluoromethoxy)phenyl]cyclobutyl]-1H-pyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC2(c3ccc(OC(F)(F)F)cc3)CCC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-10-21-13(9-14(24)22-10)15(25)23-16(7-2-8-16)11-3-5-12(6-4-11)26-17(18,19)20/h3-6,9H,2,7-8H2,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | NVNFAHGLGFPVGM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |